C24H32O2 — CID 140510254
5,7-ditert-butyl-3-(1,6-dimethylcyclohexa-2,4-dien-1-yl)-3H-1-benzofuran-2-one (PubChem CID 140510254) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is 5,7-ditert-butyl-3-(1,6-dimethylcyclohexa-2,4-dien-1-yl)-3H-1-benzofuran-2-one.
| Compound Name | 5,7-ditert-butyl-3-(1,6-dimethylcyclohexa-2,4-dien-1-yl)-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 140510254 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 5,7-ditert-butyl-3-(1,6-dimethylcyclohexa-2,4-dien-1-yl)-3H-1-benzofuran-2-one |
| SMILES | CC1C=CC=CC1(C)C1C(=O)Oc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/C24H32O2/c1-15-11-9-10-12-24(15,8)19-17-13-16(22(2,3)4)14-18(23(5,6)7)20(17)26-21(19)25/h9-15,19H,1-8H3 |
| InChIKey | VOULBGBLCFVMFP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|