C15H16FN4O8P — CID 140510444
[(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 140510444) has the molecular formula C15H16FN4O8P and a molecular weight of 430.29 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140510444 |
| Molecular Formula | C15H16FN4O8P |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]1n1cc2c(F)cc3c(=O)[nH]ncc(n1)c23 |
| InChI | InChI=1S/C15H16FN4O8P/c1-15(23)12(21)10(5-27-29(24,25)26)28-14(15)20-4-7-8(16)2-6-11(7)9(19-20)3-17-18-13(6)22/h2-4,10,12,14,21,23H,5H2,1H3,(H,18,22)(H2,24,25,26)/t10-,12-,14-,15-/m1/s1 |
| InChIKey | QOQBYBPGQGWRTG-PZTHBURQSA-N |
| XLogP | -0.47 |
| TPSA | 180.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|