C15H18FN4O14P3 — CID 140510454
[[(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 140510454) has the molecular formula C15H18FN4O14P3 and a molecular weight of 590.24 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 140510454 |
| Molecular Formula | C15H18FN4O14P3 |
| Molecular Weight | 590.24 g/mol |
| Exact Mass | 590.00 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(3-fluoro-12-oxo-6,7,10,11-tetrazatricyclo[6.4.1.04,13]trideca-1(13),2,4,7,9-pentaen-6-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc2c(F)cc3c(=O)[nH]ncc(n1)c23 |
| InChI | InChI=1S/C15H18FN4O14P3/c1-15(23)12(21)10(5-31-36(27,28)34-37(29,30)33-35(24,25)26)32-14(15)20-4-7-8(16)2-6-11(7)9(19-20)3-17-18-13(6)22/h2-4,10,12,14,21,23H,5H2,1H3,(H,18,22)(H,27,28)(H,29,30)(H2,24,25,26)/t10-,12-,14-,15-/m1/s1 |
| InChIKey | GMKXGKMKRIHODZ-PZTHBURQSA-N |
| XLogP | -0.24 |
| TPSA | 273.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|