C50H60N2O12 — CID 140510984
bis[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl-methylamino]ethyl] oxalate (PubChem CID 140510984) has the molecular formula C50H60N2O12 and a molecular weight of 881.03 g/mol. Its IUPAC name is bis[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl-methylamino]ethyl] oxalate.
| Compound Name | bis[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl-methylamino]ethyl] oxalate |
|---|---|
| PubChem CID | 140510984 |
| Molecular Formula | C50H60N2O12 |
| Molecular Weight | 881.03 g/mol |
| Exact Mass | 880.41 |
| IUPAC Name | bis[2-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl-methylamino]ethyl] oxalate |
| SMILES | CN(CCOC(=O)C(=O)OCCN(C)C(c1ccc(C(=O)C(C)(C)O)cc1)c1ccc(C(=O)C(C)(C)O)cc1)C(c1ccc(C(=O)C(C)(C)O)cc1)c1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C50H60N2O12/c1-47(2,59)41(53)35-19-11-31(12-20-35)39(32-13-21-36(22-14-32)42(54)48(3,4)60)51(9)27-29-63-45(57)46(58)64-30-28-52(10)40(33-15-23-37(24-16-33)43(55)49(5,6)61)34-17-25-38(26-18-34)44(56)50(7,8)62/h11-26,39-40,59-62H,27-30H2,1-10H3 |
| InChIKey | SDNOKXPCZQGYLN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 208.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|