C36H50N5O2S2+ — CID 140511038
N,N-dimethyl-N'-[4-[(Z)-(3-methyl-6-piperidin-1-ylsulfonyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-N'-propylethane-1,2-diamine (PubChem CID 140511038) has the molecular formula C36H50N5O2S2+ and a molecular weight of 648.96 g/mol. Its IUPAC name is N,N-dimethyl-N'-[4-[(Z)-(3-methyl-6-piperidin-1-ylsulfonyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-N'-propylethane-1,2-diamine.
| Compound Name | N,N-dimethyl-N'-[4-[(Z)-(3-methyl-6-piperidin-1-ylsulfonyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 140511038 |
| Molecular Formula | C36H50N5O2S2+ |
| Molecular Weight | 648.96 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | N,N-dimethyl-N'-[4-[(Z)-(3-methyl-6-piperidin-1-ylsulfonyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN(C)C)c1cc(/C=C2\SC3CC(S(=O)(=O)N4CCCCC4)CCC3N2C)c2ccccc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C36H50N5O2S2/c1-5-20-39(24-23-37(2)3)35-25-28(31-16-10-11-17-32(31)41(35)29-14-8-6-9-15-29)26-36-38(4)33-19-18-30(27-34(33)44-36)45(42,43)40-21-12-7-13-22-40/h6,8-11,14-17,25-26,30,33-34H,5,7,12-13,18-24,27H2,1-4H3/q+1 |
| InChIKey | FKSVKHQQMQGUHB-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 50.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.96 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|