C8H5N5 — CID 140511234
3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaen-7-amine (PubChem CID 140511234) has the molecular formula C8H5N5 and a molecular weight of 171.16 g/mol. Its IUPAC name is 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaen-7-amine.
| Compound Name | 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaen-7-amine |
|---|---|
| PubChem CID | 140511234 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,5,7,9,11-hexaen-7-amine |
| SMILES | Nc1nc2c(c3c1=NC=N3)C=CN=2 |
| InChI | InChI=1S/C8H5N5/c9-7-6-5(11-3-12-6)4-1-2-10-8(4)13-7/h1-3H,(H2,9,10,13) |
| InChIKey | JJNQXAUIYHTLAF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |