C38H46Zr — CID 140511495
2-tert-butylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;2-phenylethylidenezirconium(2+) (PubChem CID 140511495) has the molecular formula C38H46Zr and a molecular weight of 594.01 g/mol. Its IUPAC name is 2-tert-butylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;2-phenylethylidenezirconium(2+).
| Compound Name | 2-tert-butylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;2-phenylethylidenezirconium(2+) |
|---|---|
| PubChem CID | 140511495 |
| Molecular Formula | C38H46Zr |
| Molecular Weight | 594.01 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | 2-tert-butylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;2-phenylethylidenezirconium(2+) |
| SMILES | CC(C)(C)C1=CC[C-]=C1.CC(C)(C)c1[c-]c2c(cc1)-c1ccc(C(C)(C)C)cc1C2.[Zr+2]=CCc1ccccc1 |
| InChI | InChI=1S/C21H25.C9H13.C8H8.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-9(2,3)8-6-4-5-7-8;1-2-8-6-4-3-5-7-8;/h7-10,12H,11H2,1-6H3;6-7H,4H2,1-3H3;1,3-7H,2H2;/q2*-1;;+2 |
| InChIKey | ZHXSPHSTDOGXOY-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.01 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|