C21H23N8O3S- — CID 140511734
[6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyliminoazanide (PubChem CID 140511734) has the molecular formula C21H23N8O3S- and a molecular weight of 467.54 g/mol. Its IUPAC name is [6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyliminoazanide.
| Compound Name | [6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyliminoazanide |
|---|---|
| PubChem CID | 140511734 |
| Molecular Formula | C21H23N8O3S- |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [6-[[4-[2-(dimethylamino)ethylcarbamoyl]-1,3-thiazol-2-yl]carbamoyl]-1-oxo-2,3,4,9-tetrahydropyrido[3,4-b]indol-3-yl]methyliminoazanide |
| SMILES | CN(C)CCNC(=O)c1csc(NC(=O)c2ccc3[nH]c4c(c3c2)CC(CN=[N-])NC4=O)n1 |
| InChI | InChI=1S/C21H23N8O3S/c1-29(2)6-5-23-19(31)16-10-33-21(27-16)28-18(30)11-3-4-15-13(7-11)14-8-12(9-24-22)25-20(32)17(14)26-15/h3-4,7,10,12,26H,5-6,8-9H2,1-2H3,(H,23,31)(H,25,32)(H,27,28,30)/q-1 |
| InChIKey | QIRCDNMPPJYPBW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 153.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|