C28H13Cl6F17N4O2 — CID 140511796
N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzamide (PubChem CID 140511796) has the molecular formula C28H13Cl6F17N4O2 and a molecular weight of 973.12 g/mol. Its IUPAC name is N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzamide.
| Compound Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzamide |
|---|---|
| PubChem CID | 140511796 |
| Molecular Formula | C28H13Cl6F17N4O2 |
| Molecular Weight | 973.12 g/mol |
| Exact Mass | 969.89 |
| IUPAC Name | N-[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl]-4-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecoxy)benzamide |
| SMILES | O=C(Nc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)c1ccc(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H13Cl6F17N4O2/c29-20(30,31)17-53-15(54-18(55-17)21(32,33)34)11-1-5-13(6-2-11)52-16(56)12-3-7-14(8-4-12)57-10-9-19(35,36)22(37,38)23(39,40)24(41,42)25(43,44)26(45,46)27(47,48)28(49,50)51/h1-8H,9-10H2,(H,52,56) |
| InChIKey | KSTFXLQUUHBRBA-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 973.12 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|