C31H12Cl6F34N4 — CID 140511797
4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)aniline (PubChem CID 140511797) has the molecular formula C31H12Cl6F34N4 and a molecular weight of 1299.11 g/mol. Its IUPAC name is 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)aniline.
| Compound Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)aniline |
|---|---|
| PubChem CID | 140511797 |
| Molecular Formula | C31H12Cl6F34N4 |
| Molecular Weight | 1299.11 g/mol |
| Exact Mass | 1295.87 |
| IUPAC Name | 4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-N,N-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)aniline |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C31H12Cl6F34N4/c32-16(33,34)12-72-11(73-13(74-12)17(35,36)37)9-1-3-10(4-2-9)75(7-5-14(38,39)18(42,43)20(46,47)22(50,51)24(54,55)26(58,59)28(62,63)30(66,67)68)8-6-15(40,41)19(44,45)21(48,49)23(52,53)25(56,57)27(60,61)29(64,65)31(69,70)71/h1-4H,5-8H2 |
| InChIKey | QMIMNSSNBNSNMW-UHFFFAOYSA-N |
| XLogP | 16.80 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1299.11 |
| LogP ≤ 5 | 16.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|