C38H16Cl6F34N4O2 — CID 140511806
[4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl] 4-[bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]benzoate (PubChem CID 140511806) has the molecular formula C38H16Cl6F34N4O2 and a molecular weight of 1419.22 g/mol. Its IUPAC name is [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl] 4-[bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]benzoate.
| Compound Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl] 4-[bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]benzoate |
|---|---|
| PubChem CID | 140511806 |
| Molecular Formula | C38H16Cl6F34N4O2 |
| Molecular Weight | 1419.22 g/mol |
| Exact Mass | 1415.89 |
| IUPAC Name | [4-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]phenyl] 4-[bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)amino]benzoate |
| SMILES | O=C(Oc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1)c1ccc(N(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C38H16Cl6F34N4O2/c39-23(40,41)19-79-17(80-20(81-19)24(42,43)44)13-3-7-16(8-4-13)84-18(83)14-1-5-15(6-2-14)82(11-9-21(45,46)25(49,50)27(53,54)29(57,58)31(61,62)33(65,66)35(69,70)37(73,74)75)12-10-22(47,48)26(51,52)28(55,56)30(59,60)32(63,64)34(67,68)36(71,72)38(76,77)78/h1-8H,9-12H2 |
| InChIKey | DMDOMXUHKGCXKC-UHFFFAOYSA-N |
| XLogP | 18.02 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1419.22 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|