C12H14BBrN2O2 — CID 140512018
5-bromo-2-isocyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 140512018) has the molecular formula C12H14BBrN2O2 and a molecular weight of 308.97 g/mol. Its IUPAC name is 5-bromo-2-isocyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 5-bromo-2-isocyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 140512018 |
| Molecular Formula | C12H14BBrN2O2 |
| Molecular Weight | 308.97 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 5-bromo-2-isocyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | [C-]#[N+]c1ncc(Br)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H14BBrN2O2/c1-11(2)12(3,4)18-13(17-11)9-6-8(14)7-16-10(9)15-5/h6-7H,1-4H3 |
| InChIKey | IKTUKLQKYVBLBP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|