C14H16BrF4NO2 — CID 140512076
2-[[(2S)-2-(4-bromophenyl)-1,1,2-trifluoroethyl]amino]-4-fluoro-4-methylpentanoic acid (PubChem CID 140512076) has the molecular formula C14H16BrF4NO2 and a molecular weight of 386.18 g/mol. Its IUPAC name is 2-[[(2S)-2-(4-bromophenyl)-1,1,2-trifluoroethyl]amino]-4-fluoro-4-methylpentanoic acid.
| Compound Name | 2-[[(2S)-2-(4-bromophenyl)-1,1,2-trifluoroethyl]amino]-4-fluoro-4-methylpentanoic acid |
|---|---|
| PubChem CID | 140512076 |
| Molecular Formula | C14H16BrF4NO2 |
| Molecular Weight | 386.18 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-[[(2S)-2-(4-bromophenyl)-1,1,2-trifluoroethyl]amino]-4-fluoro-4-methylpentanoic acid |
| SMILES | CC(C)(F)CC(NC(F)(F)[C@@H](F)c1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C14H16BrF4NO2/c1-13(2,17)7-10(12(21)22)20-14(18,19)11(16)8-3-5-9(15)6-4-8/h3-6,10-11,20H,7H2,1-2H3,(H,21,22)/t10?,11-/m0/s1 |
| InChIKey | WRRNLLZTPASFBJ-DTIOYNMSSA-N |
| XLogP | 4.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.18 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|