C18H24N4O3 — CID 140513124
tert-butyl 4-(1H-benzimidazole-4-carbonylamino)piperidine-1-carboxylate (PubChem CID 140513124) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is tert-butyl 4-(1H-benzimidazole-4-carbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(1H-benzimidazole-4-carbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140513124 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | tert-butyl 4-(1H-benzimidazole-4-carbonylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)c2cccc3[nH]cnc23)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-18(2,3)25-17(24)22-9-7-12(8-10-22)21-16(23)13-5-4-6-14-15(13)20-11-19-14/h4-6,11-12H,7-10H2,1-3H3,(H,19,20)(H,21,23) |
| InChIKey | RHHNUXAMLBIASU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |