C29H52N4 — CID 140513402
4-[[4,4-bis(butan-2-ylamino)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N'-di(butan-2-yl)cyclohexa-2,4-diene-1,1-diamine (PubChem CID 140513402) has the molecular formula C29H52N4 and a molecular weight of 456.76 g/mol. Its IUPAC name is 4-[[4,4-bis(butan-2-ylamino)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N'-di(butan-2-yl)cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-[[4,4-bis(butan-2-ylamino)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N'-di(butan-2-yl)cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 140513402 |
| Molecular Formula | C29H52N4 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 4-[[4,4-bis(butan-2-ylamino)cyclohexa-1,5-dien-1-yl]methyl]-1-N,1-N'-di(butan-2-yl)cyclohexa-2,4-diene-1,1-diamine |
| SMILES | CCC(C)NC1(NC(C)CC)C=CC(CC2=CCC(NC(C)CC)(NC(C)CC)C=C2)=CC1 |
| InChI | InChI=1S/C29H52N4/c1-9-22(5)30-28(31-23(6)10-2)17-13-26(14-18-28)21-27-15-19-29(20-16-27,32-24(7)11-3)33-25(8)12-4/h13-17,19,22-25,30-33H,9-12,18,20-21H2,1-8H3 |
| InChIKey | VSCJKWJOTVWPHM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|