C31H34Cl2N3NaO6 — CID 140513630
sodium 4-[[3-[2,5-dichloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]-2-oxopropoxy]-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate (PubChem CID 140513630) has the molecular formula C31H34Cl2N3NaO6 and a molecular weight of 638.52 g/mol. Its IUPAC name is sodium 4-[[3-[2,5-dichloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]-2-oxopropoxy]-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate.
| Compound Name | sodium 4-[[3-[2,5-dichloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]-2-oxopropoxy]-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 140513630 |
| Molecular Formula | C31H34Cl2N3NaO6 |
| Molecular Weight | 638.52 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | sodium 4-[[3-[2,5-dichloro-4-[(1-methylindole-3-carbonyl)amino]phenyl]-2-oxopropoxy]-pyrrolidin-1-ylmethoxy]cyclohexane-1-carboxylate |
| SMILES | Cn1cc(C(=O)Nc2cc(Cl)c(CC(=O)COC(OC3CCC(C(=O)[O-])CC3)N3CCCC3)cc2Cl)c2ccccc21.[Na+] |
| InChI | InChI=1S/C31H35Cl2N3O6.Na/c1-35-17-24(23-6-2-3-7-28(23)35)29(38)34-27-16-25(32)20(15-26(27)33)14-21(37)18-41-31(36-12-4-5-13-36)42-22-10-8-19(9-11-22)30(39)40;/h2-3,6-7,15-17,19,22,31H,4-5,8-14,18H2,1H3,(H,34,38)(H,39,40);/q;+1/p-1 |
| InChIKey | HSTSTAVPYBXLCY-UHFFFAOYSA-M |
| XLogP | 1.57 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.52 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|