About 3,4-dinitrocyclohexan-1-ol
3,4-dinitrocyclohexan-1-ol (PubChem CID 140514196) has the molecular formula C6H10N2O5
and a molecular weight of 190.15 g/mol. Its IUPAC name is 3,4-dinitrocyclohexan-1-ol.
Molecular Properties
| Compound Name | 3,4-dinitrocyclohexan-1-ol |
| PubChem CID | 140514196 |
| Molecular Formula | C6H10N2O5 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3,4-dinitrocyclohexan-1-ol |
| SMILES | O=[N+]([O-])C1CCC(O)CC1[N+](=O)[O-] |
| InChI | InChI=1S/C6H10N2O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h4-6,9H,1-3H2 |
| InChIKey | RYNLPKSWVRNIAC-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dinitrocyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitrocyclohexan-1-ol?
The IUPAC name of 3,4-dinitrocyclohexan-1-ol (CID 140514196) is 3,4-dinitrocyclohexan-1-ol.
What is the SMILES notation for 3,4-dinitrocyclohexan-1-ol?
The canonical SMILES for 3,4-dinitrocyclohexan-1-ol is O=[N+]([O-])C1CCC(O)CC1[N+](=O)[O-].
What is the InChIKey of 3,4-dinitrocyclohexan-1-ol?
The InChIKey is RYNLPKSWVRNIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O5/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h4-6,9H,1-3H2.
What are the key properties of 3,4-dinitrocyclohexan-1-ol?
3,4-dinitrocyclohexan-1-ol has a molecular weight of 190.15 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitrocyclohexan-1-ol is sourced from PubChem (CID 140514196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).