C26H39FOSi — CID 140514538
tert-butyl-[[(8S,9R,13S,14S,17S)-9-ethenyl-17-fluoro-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methoxy]-dimethylsilane (PubChem CID 140514538) has the molecular formula C26H39FOSi and a molecular weight of 414.68 g/mol. Its IUPAC name is tert-butyl-[[(8S,9R,13S,14S,17S)-9-ethenyl-17-fluoro-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(8S,9R,13S,14S,17S)-9-ethenyl-17-fluoro-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 140514538 |
| Molecular Formula | C26H39FOSi |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | tert-butyl-[[(8S,9R,13S,14S,17S)-9-ethenyl-17-fluoro-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-13-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@]12CC[C@]3(CO[Si](C)(C)C(C)(C)C)[C@@H](F)CC[C@H]3[C@@H]1CCc1ccccc12 |
| InChI | InChI=1S/C26H39FOSi/c1-7-25-16-17-26(18-28-29(5,6)24(2,3)4)22(14-15-23(26)27)21(25)13-12-19-10-8-9-11-20(19)25/h7-11,21-23H,1,12-18H2,2-6H3/t21-,22-,23-,25+,26+/m0/s1 |
| InChIKey | XBBKBLKXVBRBCE-AZQMGYJQSA-N |
| XLogP | 7.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|