C15H28FNO — CID 140515379
(2S)-2-[[(S)-cyclopropyl-(2-fluorocyclohexyl)methyl]amino]-3-methylbutan-1-ol (PubChem CID 140515379) has the molecular formula C15H28FNO and a molecular weight of 257.39 g/mol. Its IUPAC name is (2S)-2-[[(S)-cyclopropyl-(2-fluorocyclohexyl)methyl]amino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[[(S)-cyclopropyl-(2-fluorocyclohexyl)methyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 140515379 |
| Molecular Formula | C15H28FNO |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | (2S)-2-[[(S)-cyclopropyl-(2-fluorocyclohexyl)methyl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)N[C@@H](C1CC1)C1CCCCC1F |
| InChI | InChI=1S/C15H28FNO/c1-10(2)14(9-18)17-15(11-7-8-11)12-5-3-4-6-13(12)16/h10-15,17-18H,3-9H2,1-2H3/t12?,13?,14-,15+/m1/s1 |
| InChIKey | SDQYDVBKNMFHRA-CVSAEHQPSA-N |
| XLogP | 2.90 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |