About 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate
2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate (PubChem CID 140515572) has the molecular formula C25H21F2NO4
and a molecular weight of 437.44 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate.
Molecular Properties
| Compound Name | 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate |
| PubChem CID | 140515572 |
| Molecular Formula | C25H21F2NO4 |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate |
| SMILES | O=C(OCCC1(c2ccc(F)c(F)c2)CN(c2ccccc2)C(=O)CO1)c1ccccc1 |
| InChI | InChI=1S/C25H21F2NO4/c26-21-12-11-19(15-22(21)27)25(13-14-31-24(30)18-7-3-1-4-8-18)17-28(23(29)16-32-25)20-9-5-2-6-10-20/h1-12,15H,13-14,16-17H2 |
| InChIKey | CEBBMVOQKUBFQR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate?
The IUPAC name of 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate (CID 140515572) is 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate.
What is the SMILES notation for 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate?
The canonical SMILES for 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate is O=C(OCCC1(c2ccc(F)c(F)c2)CN(c2ccccc2)C(=O)CO1)c1ccccc1.
What is the InChIKey of 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate?
The InChIKey is CEBBMVOQKUBFQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21F2NO4/c26-21-12-11-19(15-22(21)27)25(13-14-31-24(30)18-7-3-1-4-8-18)17-28(23(29)16-32-25)20-9-5-2-6-10-20/h1-12,15H,13-14,16-17H2.
What are the key properties of 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate?
2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate has a molecular weight of 437.44 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-difluorophenyl)-5-oxo-4-phenylmorpholin-2-yl]ethyl benzoate is sourced from PubChem (CID 140515572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).