C18H26N4O2S2 — CID 1405157
2-[[(12S)-3-amino-12-propan-2-yl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N,N-diethylacetamide (PubChem CID 1405157) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 2-[[(12S)-3-amino-12-propan-2-yl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N,N-diethylacetamide.
| Compound Name | 2-[[(12S)-3-amino-12-propan-2-yl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 1405157 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[[(12S)-3-amino-12-propan-2-yl-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-5-yl]sulfanyl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc(N)c2c3c(sc2n1)CO[C@H](C(C)C)C3 |
| InChI | InChI=1S/C18H26N4O2S2/c1-5-22(6-2)14(23)9-25-18-20-16(19)15-11-7-12(10(3)4)24-8-13(11)26-17(15)21-18/h10,12H,5-9H2,1-4H3,(H2,19,20,21)/t12-/m0/s1 |
| InChIKey | JOCQWFRWJPDJDC-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |