C23H42N4O2 — CID 140516084
5-(4-methoxycyclohexyl)-N-[4-[2-[methyl(prop-2-ynyl)amino]ethoxy]cyclohexyl]-1,3-diazinan-2-amine (PubChem CID 140516084) has the molecular formula C23H42N4O2 and a molecular weight of 406.62 g/mol. Its IUPAC name is 5-(4-methoxycyclohexyl)-N-[4-[2-[methyl(prop-2-ynyl)amino]ethoxy]cyclohexyl]-1,3-diazinan-2-amine.
| Compound Name | 5-(4-methoxycyclohexyl)-N-[4-[2-[methyl(prop-2-ynyl)amino]ethoxy]cyclohexyl]-1,3-diazinan-2-amine |
|---|---|
| PubChem CID | 140516084 |
| Molecular Formula | C23H42N4O2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 5-(4-methoxycyclohexyl)-N-[4-[2-[methyl(prop-2-ynyl)amino]ethoxy]cyclohexyl]-1,3-diazinan-2-amine |
| SMILES | C#CCN(C)CCOC1CCC(NC2NCC(C3CCC(OC)CC3)CN2)CC1 |
| InChI | InChI=1S/C23H42N4O2/c1-4-13-27(2)14-15-29-22-11-7-20(8-12-22)26-23-24-16-19(17-25-23)18-5-9-21(28-3)10-6-18/h1,18-26H,5-17H2,2-3H3 |
| InChIKey | SRRPGBLQLPOVNH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 57.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|