About 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol
6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol (PubChem CID 140516185) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol |
| PubChem CID | 140516185 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol |
| SMILES | CN[C@@H](C)[C@@H](O)C1C=CC=CC1O |
| InChI | InChI=1S/C10H17NO2/c1-7(11-2)10(13)8-5-3-4-6-9(8)12/h3-13H,1-2H3/t7-,8?,9?,10+/m0/s1 |
| InChIKey | JBTBHPOACWFDMY-AUXWQGHOSA-N |
| XLogP | 0.06 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol?
The IUPAC name of 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol (CID 140516185) is 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol is CN[C@@H](C)[C@@H](O)C1C=CC=CC1O.
What is the InChIKey of 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol?
The InChIKey is JBTBHPOACWFDMY-AUXWQGHOSA-N. The full InChI is InChI=1S/C10H17NO2/c1-7(11-2)10(13)8-5-3-4-6-9(8)12/h3-13H,1-2H3/t7-,8?,9?,10+/m0/s1.
What are the key properties of 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol?
6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol has a molecular weight of 183.25 g/mol, XLogP of 0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,2S)-1-hydroxy-2-(methylamino)propyl]cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 140516185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).