About 3-bromo-1,2,3,5-tetrahydroindolizine
3-bromo-1,2,3,5-tetrahydroindolizine (PubChem CID 140516211) has the molecular formula C8H10BrN
and a molecular weight of 200.08 g/mol. Its IUPAC name is 3-bromo-1,2,3,5-tetrahydroindolizine.
Molecular Properties
| Compound Name | 3-bromo-1,2,3,5-tetrahydroindolizine |
| PubChem CID | 140516211 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 3-bromo-1,2,3,5-tetrahydroindolizine |
| SMILES | BrC1CCC2=CC=CCN21 |
| InChI | InChI=1S/C8H10BrN/c9-8-5-4-7-3-1-2-6-10(7)8/h1-3,8H,4-6H2 |
| InChIKey | VLKLHGWZTYKRRF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1,2,3,5-tetrahydroindolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,2,3,5-tetrahydroindolizine?
The IUPAC name of 3-bromo-1,2,3,5-tetrahydroindolizine (CID 140516211) is 3-bromo-1,2,3,5-tetrahydroindolizine.
What is the SMILES notation for 3-bromo-1,2,3,5-tetrahydroindolizine?
The canonical SMILES for 3-bromo-1,2,3,5-tetrahydroindolizine is BrC1CCC2=CC=CCN21.
What is the InChIKey of 3-bromo-1,2,3,5-tetrahydroindolizine?
The InChIKey is VLKLHGWZTYKRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrN/c9-8-5-4-7-3-1-2-6-10(7)8/h1-3,8H,4-6H2.
What are the key properties of 3-bromo-1,2,3,5-tetrahydroindolizine?
3-bromo-1,2,3,5-tetrahydroindolizine has a molecular weight of 200.08 g/mol, XLogP of 2.26, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,2,3,5-tetrahydroindolizine is sourced from PubChem (CID 140516211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).