C30H29ClN2O4 — CID 140516216
N,N-dimethyl-4-[(1-methyl-2,4-diphenyl-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ylidene)methyl]aniline perchlorate (PubChem CID 140516216) has the molecular formula C30H29ClN2O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1-methyl-2,4-diphenyl-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ylidene)methyl]aniline perchlorate.
| Compound Name | N,N-dimethyl-4-[(1-methyl-2,4-diphenyl-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ylidene)methyl]aniline perchlorate |
|---|---|
| PubChem CID | 140516216 |
| Molecular Formula | C30H29ClN2O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | N,N-dimethyl-4-[(1-methyl-2,4-diphenyl-5,6-dihydrocyclopenta[b]pyridin-1-ium-7-ylidene)methyl]aniline perchlorate |
| SMILES | CN(C)c1ccc(C=C2CCc3c(-c4ccccc4)cc(-c4ccccc4)[n+](C)c32)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C30H29N2.ClHO4/c1-31(2)26-17-14-22(15-18-26)20-25-16-19-27-28(23-10-6-4-7-11-23)21-29(32(3)30(25)27)24-12-8-5-9-13-24;2-1(3,4)5/h4-15,17-18,20-21H,16,19H2,1-3H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | KRFNNDRCESPHAW-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|