C28H46O3 — CID 140516484
(9E)-11,11-dimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 140516484) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is (9E)-11,11-dimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-11,11-dimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 140516484 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | (9E)-11,11-dimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | CCCC(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CCCCCC/C=C/C1(C)C |
| InChI | InChI=1S/C28H46O3/c1-7-15-22(3)26-24(30-26)20-21(2)16-14-17-23(4)27-28(5,6)19-13-11-9-8-10-12-18-25(29)31-27/h13-14,16-17,19,21-22,24,26-27H,7-12,15,18,20H2,1-6H3/b16-14+,19-13+,23-17+ |
| InChIKey | LSUAOENEKBLOFP-KYPFXUOFSA-N |
| XLogP | 7.57 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|