C29H48O3 — CID 140516486
(9E)-7,7,11-trimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 140516486) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (9E)-7,7,11-trimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (9E)-7,7,11-trimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 140516486 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (9E)-7,7,11-trimethyl-12-[(2E,4E)-6-methyl-7-(3-pentan-2-yloxiran-2-yl)hepta-2,4-dien-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | CCCC(C)C1OC1CC(C)/C=C/C=C(\C)C1OC(=O)CCCCC(C)(C)C/C=C/C1C |
| InChI | InChI=1S/C29H48O3/c1-8-13-22(3)28-25(31-28)20-21(2)14-11-15-23(4)27-24(5)16-12-19-29(6,7)18-10-9-17-26(30)32-27/h11-12,14-16,21-22,24-25,27-28H,8-10,13,17-20H2,1-7H3/b14-11+,16-12+,23-15+ |
| InChIKey | PQSMNQOSNJDVPK-SVGSWLHMSA-N |
| XLogP | 7.81 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|