C23H22FNO5S — CID 140516815
2-[(7S,8R,8aR)-6-ethylsulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione (PubChem CID 140516815) has the molecular formula C23H22FNO5S and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[(7S,8R,8aR)-6-ethylsulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(7S,8R,8aR)-6-ethylsulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140516815 |
| Molecular Formula | C23H22FNO5S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[(7S,8R,8aR)-6-ethylsulfanyl-8-fluoro-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]isoindole-1,3-dione |
| SMILES | CCSC1OC2COC(c3ccccc3)O[C@H]2[C@H](F)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22FNO5S/c1-2-31-23-18(25-20(26)14-10-6-7-11-15(14)21(25)27)17(24)19-16(29-23)12-28-22(30-19)13-8-4-3-5-9-13/h3-11,16-19,22-23H,2,12H2,1H3/t16?,17-,18+,19-,22?,23?/m1/s1 |
| InChIKey | UBLSCSADBSOVIL-WEJOWVSOSA-N |
| XLogP | 3.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|