About 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene
3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 140517812) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene.
Molecular Properties
| Compound Name | 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene |
| PubChem CID | 140517812 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | CCC1=CCC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C12H16/c1-2-8-5-6-11-9-3-4-10(7-9)12(8)11/h3-5,9-12H,2,6-7H2,1H3 |
| InChIKey | MJPQRIPEFJDVFR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene?
The IUPAC name of 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene (CID 140517812) is 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene.
What is the SMILES notation for 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene?
The canonical SMILES for 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene is CCC1=CCC2C3C=CC(C3)C12.
What is the InChIKey of 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene?
The InChIKey is MJPQRIPEFJDVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-2-8-5-6-11-9-3-4-10(7-9)12(8)11/h3-5,9-12H,2,6-7H2,1H3.
What are the key properties of 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene?
3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene has a molecular weight of 160.26 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyltricyclo[5.2.1.02,6]deca-3,8-diene is sourced from PubChem (CID 140517812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).