C13H21N3O3 — CID 140517911
ethyl (6Z)-6-(dimethylaminomethylidene)-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-indazole-3-carboxylate (PubChem CID 140517911) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is ethyl (6Z)-6-(dimethylaminomethylidene)-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-indazole-3-carboxylate.
| Compound Name | ethyl (6Z)-6-(dimethylaminomethylidene)-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 140517911 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | ethyl (6Z)-6-(dimethylaminomethylidene)-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-indazole-3-carboxylate |
| SMILES | CCOC(=O)C1NNC2C(=O)/C(=C\N(C)C)CCC12 |
| InChI | InChI=1S/C13H21N3O3/c1-4-19-13(18)11-9-6-5-8(7-16(2)3)12(17)10(9)14-15-11/h7,9-11,14-15H,4-6H2,1-3H3/b8-7- |
| InChIKey | RWSNMZLHJRKELC-FPLPWBNLSA-N |
| XLogP | -0.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|