About 6H-1,2-benzodiazepine-4,7-dione
6H-1,2-benzodiazepine-4,7-dione (PubChem CID 140518023) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 6H-1,2-benzodiazepine-4,7-dione.
Molecular Properties
| Compound Name | 6H-1,2-benzodiazepine-4,7-dione |
| PubChem CID | 140518023 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 6H-1,2-benzodiazepine-4,7-dione |
| SMILES | O=C1C=Cc2nncc(=O)cc2C1 |
| InChI | InChI=1S/C9H6N2O2/c12-7-1-2-9-6(3-7)4-8(13)5-10-11-9/h1-2,4-5H,3H2 |
| InChIKey | BBQGORZUWCUBPB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6H-1,2-benzodiazepine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-1,2-benzodiazepine-4,7-dione?
The IUPAC name of 6H-1,2-benzodiazepine-4,7-dione (CID 140518023) is 6H-1,2-benzodiazepine-4,7-dione.
What is the SMILES notation for 6H-1,2-benzodiazepine-4,7-dione?
The canonical SMILES for 6H-1,2-benzodiazepine-4,7-dione is O=C1C=Cc2nncc(=O)cc2C1.
What is the InChIKey of 6H-1,2-benzodiazepine-4,7-dione?
The InChIKey is BBQGORZUWCUBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-7-1-2-9-6(3-7)4-8(13)5-10-11-9/h1-2,4-5H,3H2.
What are the key properties of 6H-1,2-benzodiazepine-4,7-dione?
6H-1,2-benzodiazepine-4,7-dione has a molecular weight of 174.16 g/mol, XLogP of -0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-1,2-benzodiazepine-4,7-dione is sourced from PubChem (CID 140518023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).