C10H11N3O3 — CID 140518095
6-oxo-5-(2-oxopyrrolidin-1-yl)-1H-pyridine-3-carboxamide (PubChem CID 140518095) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 6-oxo-5-(2-oxopyrrolidin-1-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-oxo-5-(2-oxopyrrolidin-1-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140518095 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 6-oxo-5-(2-oxopyrrolidin-1-yl)-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1c[nH]c(=O)c(N2CCCC2=O)c1 |
| InChI | InChI=1S/C10H11N3O3/c11-9(15)6-4-7(10(16)12-5-6)13-3-1-2-8(13)14/h4-5H,1-3H2,(H2,11,15)(H,12,16) |
| InChIKey | XJWYSFVBAANAIU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |