About carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium
carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium (PubChem CID 140518358) has the molecular formula C17H33NO3
and a molecular weight of 299.45 g/mol. Its IUPAC name is carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium.
Molecular Properties
| Compound Name | carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium |
| PubChem CID | 140518358 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium |
| SMILES | C=CC(=O)C([NH3+])(CCCCCCCCCC)C(=O)OC.[CH3-] |
| InChI | InChI=1S/C16H29NO3.CH3/c1-4-6-7-8-9-10-11-12-13-16(17,14(18)5-2)15(19)20-3;/h5H,2,4,6-13,17H2,1,3H3;1H3/q;-1/p+1 |
| InChIKey | PTOPINWZOCQGQN-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium?
The IUPAC name of carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium (CID 140518358) is carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium.
What is the SMILES notation for carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium?
The canonical SMILES for carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium is C=CC(=O)C([NH3+])(CCCCCCCCCC)C(=O)OC.[CH3-].
What is the InChIKey of carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium?
The InChIKey is PTOPINWZOCQGQN-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H29NO3.CH3/c1-4-6-7-8-9-10-11-12-13-16(17,14(18)5-2)15(19)20-3;/h5H,2,4,6-13,17H2,1,3H3;1H3/q;-1/p+1.
What are the key properties of carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium?
carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium has a molecular weight of 299.45 g/mol, XLogP of 2.88, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;(4-methoxycarbonyl-3-oxotetradec-1-en-4-yl)azanium is sourced from PubChem (CID 140518358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).