About 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide
6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide (PubChem CID 140518375) has the molecular formula C8H10F3N3O2
and a molecular weight of 237.18 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide |
| PubChem CID | 140518375 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide |
| SMILES | NC(=O)C1=C(C(F)(F)F)N(C(N)=O)CCC1 |
| InChI | InChI=1S/C8H10F3N3O2/c9-8(10,11)5-4(6(12)15)2-1-3-14(5)7(13)16/h1-3H2,(H2,12,15)(H2,13,16) |
| InChIKey | SBPIOKRHOSBFHG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide?
The IUPAC name of 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide (CID 140518375) is 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide.
What is the SMILES notation for 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide?
The canonical SMILES for 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide is NC(=O)C1=C(C(F)(F)F)N(C(N)=O)CCC1.
What is the InChIKey of 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide?
The InChIKey is SBPIOKRHOSBFHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O2/c9-8(10,11)5-4(6(12)15)2-1-3-14(5)7(13)16/h1-3H2,(H2,12,15)(H2,13,16).
What are the key properties of 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide?
6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide has a molecular weight of 237.18 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3,4-dihydro-2H-pyridine-1,5-dicarboxamide is sourced from PubChem (CID 140518375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).