C28H27ClIN3O6 — CID 140518998
N-(2-chloro-4-iodophenyl)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide (PubChem CID 140518998) has the molecular formula C28H27ClIN3O6 and a molecular weight of 663.90 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 140518998 |
| Molecular Formula | C28H27ClIN3O6 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.06 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-2-[(4R)-4-[4-[(2R)-2,3-dihydroxypropoxy]phenyl]-2,5-dioxoimidazolidin-1-yl]-3-phenylbutanamide |
| SMILES | CC(c1ccccc1)C(C(=O)Nc1ccc(I)cc1Cl)N1C(=O)N[C@H](c2ccc(OC[C@H](O)CO)cc2)C1=O |
| InChI | InChI=1S/C28H27ClIN3O6/c1-16(17-5-3-2-4-6-17)25(26(36)31-23-12-9-19(30)13-22(23)29)33-27(37)24(32-28(33)38)18-7-10-21(11-8-18)39-15-20(35)14-34/h2-13,16,20,24-25,34-35H,14-15H2,1H3,(H,31,36)(H,32,38)/t16?,20-,24-,25?/m1/s1 |
| InChIKey | SGAIJDBQTMVYTQ-MMZCEQHESA-N |
| XLogP | 4.08 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|