C13H27N11 — CID 140519096
(3R,5R)-1-[4-[(3R,5R)-3,5-diaminopiperidin-1-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 140519096) has the molecular formula C13H27N11 and a molecular weight of 337.44 g/mol. Its IUPAC name is (3R,5R)-1-[4-[(3R,5R)-3,5-diaminopiperidin-1-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5R)-1-[4-[(3R,5R)-3,5-diaminopiperidin-1-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 140519096 |
| Molecular Formula | C13H27N11 |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | (3R,5R)-1-[4-[(3R,5R)-3,5-diaminopiperidin-1-yl]-6-hydrazinyl-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | NNc1nc(N2C[C@H](N)C[C@@H](N)C2)nc(N2C[C@H](N)C[C@@H](N)C2)n1 |
| InChI | InChI=1S/C13H27N11/c14-7-1-8(15)4-23(3-7)12-19-11(22-18)20-13(21-12)24-5-9(16)2-10(17)6-24/h7-10H,1-6,14-18H2,(H,19,20,21,22)/t7-,8-,9-,10-/m1/s1 |
| InChIKey | FPSUDZDIIPUWEV-ZYUZMQFOSA-N |
| XLogP | -3.11 |
| TPSA | 187.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|