C20H41N11 — CID 140519098
(3R,5S)-1-[4-amino-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-(2-ethylpiperidin-1-yl)-1H-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 140519098) has the molecular formula C20H41N11 and a molecular weight of 435.63 g/mol. Its IUPAC name is (3R,5S)-1-[4-amino-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-(2-ethylpiperidin-1-yl)-1H-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-amino-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-(2-ethylpiperidin-1-yl)-1H-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 140519098 |
| Molecular Formula | C20H41N11 |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.35 |
| IUPAC Name | (3R,5S)-1-[4-amino-6-[(3R,5S)-3,5-diaminopiperidin-1-yl]-4-(2-ethylpiperidin-1-yl)-1H-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | CCC1CCCCN1C1(N)N=C(N2C[C@H](N)C[C@H](N)C2)NC(N2C[C@H](N)C[C@H](N)C2)=N1 |
| InChI | InChI=1S/C20H41N11/c1-2-17-5-3-4-6-31(17)20(25)27-18(29-9-13(21)7-14(22)10-29)26-19(28-20)30-11-15(23)8-16(24)12-30/h13-17H,2-12,21-25H2,1H3,(H,26,27,28)/t13-,14+,15-,16+,17? |
| InChIKey | RWWQOOIDJUHLQG-SJJOOFSGSA-N |
| XLogP | -2.14 |
| TPSA | 176.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |