C31H58O9Si2 — CID 140519743
[(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate (PubChem CID 140519743) has the molecular formula C31H58O9Si2 and a molecular weight of 630.97 g/mol. Its IUPAC name is [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate.
| Compound Name | [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 140519743 |
| Molecular Formula | C31H58O9Si2 |
| Molecular Weight | 630.97 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | [(2S,3S,4E,6S)-6-[2,3-bis(triethylsilyloxy)propyl]-2-methoxy-4-(2-methoxy-2-oxoethylidene)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](CC(CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC)O[C@@]1(OC)C(C)(C)C=O |
| InChI | InChI=1S/C31H58O9Si2/c1-12-27(33)38-29-24(20-28(34)35-10)19-25(39-31(29,36-11)30(8,9)23-32)21-26(40-42(16-5,17-6)18-7)22-37-41(13-2,14-3)15-4/h20,23,25-26,29H,12-19,21-22H2,1-11H3/b24-20+/t25-,26?,29-,31+/m0/s1 |
| InChIKey | KNKTUKWYSQEHPC-XKOUPWGYSA-N |
| XLogP | 6.57 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.97 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|