C42H51NO5Si — CID 140519869
(4S)-4-benzyl-3-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trityloxypentanoyl]-1,3-oxazolidin-2-one (PubChem CID 140519869) has the molecular formula C42H51NO5Si and a molecular weight of 677.96 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trityloxypentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trityloxypentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 140519869 |
| Molecular Formula | C42H51NO5Si |
| Molecular Weight | 677.96 g/mol |
| Exact Mass | 677.35 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-5-trityloxypentanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H51NO5Si/c1-31(29-47-42(34-22-14-9-15-23-34,35-24-16-10-17-25-35)36-26-18-11-19-27-36)38(48-49(6,7)41(3,4)5)32(2)39(44)43-37(30-46-40(43)45)28-33-20-12-8-13-21-33/h8-27,31-32,37-38H,28-30H2,1-7H3/t31-,32-,37-,38+/m0/s1 |
| InChIKey | XWIYGGMGHXULHU-HCBCFAOASA-N |
| XLogP | 9.25 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.96 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|