C31H26N4O4 — CID 140520185
[2-[(4-methoxyphenyl)methyl]indazol-5-yl] 2-[(4-methoxyphenyl)methyl]indazole-5-carboxylate (PubChem CID 140520185) has the molecular formula C31H26N4O4 and a molecular weight of 518.57 g/mol. Its IUPAC name is [2-[(4-methoxyphenyl)methyl]indazol-5-yl] 2-[(4-methoxyphenyl)methyl]indazole-5-carboxylate.
| Compound Name | [2-[(4-methoxyphenyl)methyl]indazol-5-yl] 2-[(4-methoxyphenyl)methyl]indazole-5-carboxylate |
|---|---|
| PubChem CID | 140520185 |
| Molecular Formula | C31H26N4O4 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | [2-[(4-methoxyphenyl)methyl]indazol-5-yl] 2-[(4-methoxyphenyl)methyl]indazole-5-carboxylate |
| SMILES | COc1ccc(Cn2cc3cc(OC(=O)c4ccc5nn(Cc6ccc(OC)cc6)cc5c4)ccc3n2)cc1 |
| InChI | InChI=1S/C31H26N4O4/c1-37-26-8-3-21(4-9-26)17-34-19-24-15-23(7-13-29(24)32-34)31(36)39-28-12-14-30-25(16-28)20-35(33-30)18-22-5-10-27(38-2)11-6-22/h3-16,19-20H,17-18H2,1-2H3 |
| InChIKey | MJDZGJWSWNTWTO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|