About (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane
(dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane (PubChem CID 140520987) has the molecular formula C20H20O3PSb
and a molecular weight of 461.11 g/mol. Its IUPAC name is (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane |
| PubChem CID | 140520987 |
| Molecular Formula | C20H20O3PSb |
| Molecular Weight | 461.11 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane |
| SMILES | CCP(O[Sb](=O)=O)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20OP.2O.Sb/c1-2-22(21,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h3-17H,2H2,1H3;;;/q-1;;;+1 |
| InChIKey | XNCQNOMJFKTGIT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane?
The IUPAC name of (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane (CID 140520987) is (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane.
What is the SMILES notation for (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane?
The canonical SMILES for (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane is CCP(O[Sb](=O)=O)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane?
The InChIKey is XNCQNOMJFKTGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20OP.2O.Sb/c1-2-22(21,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20;;;/h3-17H,2H2,1H3;;;/q-1;;;+1.
What are the key properties of (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane?
(dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane has a molecular weight of 461.11 g/mol, XLogP of 3.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (dioxo-λ5-stibanyl)oxy-ethyl-triphenyl-λ5-phosphane is sourced from PubChem (CID 140520987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).