C7H3NO7S2 — CID 140521011
3,3,12,12-tetraoxo-2,4-dioxa-3λ6,12λ6-dithia-1-azatricyclo[7.2.1.05,10]dodeca-5(10),6,8-trien-11-one (PubChem CID 140521011) has the molecular formula C7H3NO7S2 and a molecular weight of 277.23 g/mol. Its IUPAC name is 3,3,12,12-tetraoxo-2,4-dioxa-3λ6,12λ6-dithia-1-azatricyclo[7.2.1.05,10]dodeca-5(10),6,8-trien-11-one.
| Compound Name | 3,3,12,12-tetraoxo-2,4-dioxa-3λ6,12λ6-dithia-1-azatricyclo[7.2.1.05,10]dodeca-5(10),6,8-trien-11-one |
|---|---|
| PubChem CID | 140521011 |
| Molecular Formula | C7H3NO7S2 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 3,3,12,12-tetraoxo-2,4-dioxa-3λ6,12λ6-dithia-1-azatricyclo[7.2.1.05,10]dodeca-5(10),6,8-trien-11-one |
| SMILES | O=C1c2c3cccc2S(=O)(=O)N1OS(=O)(=O)O3 |
| InChI | InChI=1S/C7H3NO7S2/c9-7-6-4-2-1-3-5(6)16(10,11)8(7)15-17(12,13)14-4/h1-3H |
| InChIKey | IREMXQKGRDMZJJ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |