C16H21F4N5O2 — CID 140521101
1-[(3S,4S)-4-amino-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]pyrrolidin-3-yl]piperidin-2-one (PubChem CID 140521101) has the molecular formula C16H21F4N5O2 and a molecular weight of 391.37 g/mol. Its IUPAC name is 1-[(3S,4S)-4-amino-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]pyrrolidin-3-yl]piperidin-2-one.
| Compound Name | 1-[(3S,4S)-4-amino-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]pyrrolidin-3-yl]piperidin-2-one |
|---|---|
| PubChem CID | 140521101 |
| Molecular Formula | C16H21F4N5O2 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[(3S,4S)-4-amino-1-[6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-4-yl]pyrrolidin-3-yl]piperidin-2-one |
| SMILES | N[C@H]1CN(c2cc(OCC(F)(F)C(F)F)ncn2)C[C@@H]1N1CCCCC1=O |
| InChI | InChI=1S/C16H21F4N5O2/c17-15(18)16(19,20)8-27-13-5-12(22-9-23-13)24-6-10(21)11(7-24)25-4-2-1-3-14(25)26/h5,9-11,15H,1-4,6-8,21H2/t10-,11-/m0/s1 |
| InChIKey | DFZHBDRDQFHOMM-QWRGUYRKSA-N |
| XLogP | 1.28 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|