C9H17N3S — CID 140521200
3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carbothioamide (PubChem CID 140521200) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carbothioamide.
| Compound Name | 3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carbothioamide |
|---|---|
| PubChem CID | 140521200 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carbothioamide |
| SMILES | CC1NNC2CCC(C(N)=S)CC12 |
| InChI | InChI=1S/C9H17N3S/c1-5-7-4-6(9(10)13)2-3-8(7)12-11-5/h5-8,11-12H,2-4H2,1H3,(H2,10,13) |
| InChIKey | WYKRVPZYJLSVKR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|