C10H17NO — CID 140521244
5,6,7-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 140521244) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 5,6,7-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
| Compound Name | 5,6,7-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 140521244 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 5,6,7-trimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
| SMILES | CC1CC2N=COC2C(C)C1C |
| InChI | InChI=1S/C10H17NO/c1-6-4-9-10(12-5-11-9)8(3)7(6)2/h5-10H,4H2,1-3H3 |
| InChIKey | IUULMNMRPNFACF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |