About 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol
3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol (PubChem CID 140521626) has the molecular formula C6H4F6OS
and a molecular weight of 238.15 g/mol. Its IUPAC name is 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol.
Molecular Properties
| Compound Name | 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol |
| PubChem CID | 140521626 |
| Molecular Formula | C6H4F6OS |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol |
| SMILES | Oc1cccc(F)c1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C6H4F6OS/c7-4-2-1-3-5(13)6(4)14(8,9,10,11)12/h1-3,13H |
| InChIKey | SAJFZDJKFXFRFW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol?
The IUPAC name of 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol (CID 140521626) is 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol.
What is the SMILES notation for 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol?
The canonical SMILES for 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol is Oc1cccc(F)c1S(F)(F)(F)(F)F.
What is the InChIKey of 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol?
The InChIKey is SAJFZDJKFXFRFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F6OS/c7-4-2-1-3-5(13)6(4)14(8,9,10,11)12/h1-3,13H.
What are the key properties of 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol?
3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol has a molecular weight of 238.15 g/mol, XLogP of 4.19, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-(pentafluoro-λ6-sulfanyl)phenol is sourced from PubChem (CID 140521626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).