C41H70N2O3 — CID 140521718
5-(4-methoxycyclohexyl)-1,3-bis[4-(4-methoxycyclohexyl)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-2-amine (PubChem CID 140521718) has the molecular formula C41H70N2O3 and a molecular weight of 639.02 g/mol. Its IUPAC name is 5-(4-methoxycyclohexyl)-1,3-bis[4-(4-methoxycyclohexyl)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-2-amine.
| Compound Name | 5-(4-methoxycyclohexyl)-1,3-bis[4-(4-methoxycyclohexyl)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-2-amine |
|---|---|
| PubChem CID | 140521718 |
| Molecular Formula | C41H70N2O3 |
| Molecular Weight | 639.02 g/mol |
| Exact Mass | 638.54 |
| IUPAC Name | 5-(4-methoxycyclohexyl)-1,3-bis[4-(4-methoxycyclohexyl)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-2-amine |
| SMILES | COC1CCC(C2CCC(C3=C(N)N(C4CCC(C5CCC(OC)CC5)CC4)C4CCC(C5CCC(OC)CC5)CC34)CC2)CC1 |
| InChI | InChI=1S/C41H70N2O3/c1-44-35-19-10-29(11-20-35)27-4-6-32(7-5-27)40-38-26-33(31-14-23-37(46-3)24-15-31)16-25-39(38)43(41(40)42)34-17-8-28(9-18-34)30-12-21-36(45-2)22-13-30/h27-39H,4-26,42H2,1-3H3 |
| InChIKey | BDQPDKFZVPDCJB-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.02 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |