About 2-sulfanyl-1,2-dihydropyridine-3-carboxamide
2-sulfanyl-1,2-dihydropyridine-3-carboxamide (PubChem CID 140521952) has the molecular formula C6H8N2OS
and a molecular weight of 156.21 g/mol. Its IUPAC name is 2-sulfanyl-1,2-dihydropyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-sulfanyl-1,2-dihydropyridine-3-carboxamide |
| PubChem CID | 140521952 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 2-sulfanyl-1,2-dihydropyridine-3-carboxamide |
| SMILES | NC(=O)C1=CC=CNC1S |
| InChI | InChI=1S/C6H8N2OS/c7-5(9)4-2-1-3-8-6(4)10/h1-3,6,8,10H,(H2,7,9) |
| InChIKey | QGGUQXJUUOPUGD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-1,2-dihydropyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-1,2-dihydropyridine-3-carboxamide?
The IUPAC name of 2-sulfanyl-1,2-dihydropyridine-3-carboxamide (CID 140521952) is 2-sulfanyl-1,2-dihydropyridine-3-carboxamide.
What is the SMILES notation for 2-sulfanyl-1,2-dihydropyridine-3-carboxamide?
The canonical SMILES for 2-sulfanyl-1,2-dihydropyridine-3-carboxamide is NC(=O)C1=CC=CNC1S.
What is the InChIKey of 2-sulfanyl-1,2-dihydropyridine-3-carboxamide?
The InChIKey is QGGUQXJUUOPUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c7-5(9)4-2-1-3-8-6(4)10/h1-3,6,8,10H,(H2,7,9).
What are the key properties of 2-sulfanyl-1,2-dihydropyridine-3-carboxamide?
2-sulfanyl-1,2-dihydropyridine-3-carboxamide has a molecular weight of 156.21 g/mol, XLogP of -0.23, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-1,2-dihydropyridine-3-carboxamide is sourced from PubChem (CID 140521952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).