About 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid
3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 140522008) has the molecular formula C9H12O6S2
and a molecular weight of 280.32 g/mol. Its IUPAC name is 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid |
| PubChem CID | 140522008 |
| Molecular Formula | C9H12O6S2 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CS(=O)(=O)C1(S(C)(=O)=O)C=C(C(=O)O)C=CC1 |
| InChI | InChI=1S/C9H12O6S2/c1-16(12,13)9(17(2,14)15)5-3-4-7(6-9)8(10)11/h3-4,6H,5H2,1-2H3,(H,10,11) |
| InChIKey | CDZNZKDBULYJGU-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid (CID 140522008) is 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid is CS(=O)(=O)C1(S(C)(=O)=O)C=C(C(=O)O)C=CC1.
What is the InChIKey of 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is CDZNZKDBULYJGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O6S2/c1-16(12,13)9(17(2,14)15)5-3-4-7(6-9)8(10)11/h3-4,6H,5H2,1-2H3,(H,10,11).
What are the key properties of 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid?
3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 280.32 g/mol, XLogP of -0.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(methylsulfonyl)cyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 140522008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).