C22H18F5N5O4 — CID 140522062
[(3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate (PubChem CID 140522062) has the molecular formula C22H18F5N5O4 and a molecular weight of 511.41 g/mol. Its IUPAC name is [(3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate.
| Compound Name | [(3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate |
|---|---|
| PubChem CID | 140522062 |
| Molecular Formula | C22H18F5N5O4 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | [(3R)-3-amino-1-[(2S)-2-[3-(3,5-difluoro-2-pyridinyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-1-oxo-4-(2,4,5-trifluorophenyl)butan-2-yl] formate |
| SMILES | N[C@H](Cc1cc(F)c(F)cc1F)C(OC=O)C(=O)N1CCC[C@H]1c1nc(-c2ncc(F)cc2F)no1 |
| InChI | InChI=1S/C22H18F5N5O4/c23-11-6-15(27)18(29-8-11)20-30-21(36-31-20)17-2-1-3-32(17)22(34)19(35-9-33)16(28)5-10-4-13(25)14(26)7-12(10)24/h4,6-9,16-17,19H,1-3,5,28H2/t16-,17+,19?/m1/s1 |
| InChIKey | WZJFTDQKOKKGAX-FQZXCLDYSA-N |
| XLogP | 2.60 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|